C11H20N4O2 — CID 64828925
1-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol (PubChem CID 64828925) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 64828925 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1ccnc(N(C)C)n1 |
| InChI | InChI=1S/C11H20N4O2/c1-14(2)11-12-6-5-10(13-11)15(3)7-9(16)8-17-4/h5-6,9,16H,7-8H2,1-4H3 |
| InChIKey | JJTWBKCORDWEQJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |