C11H19N3O3 — CID 54993621
1-[(5-amino-6-methoxy-2-pyridinyl)-methylamino]-3-methoxypropan-2-ol (PubChem CID 54993621) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-[(5-amino-6-methoxy-2-pyridinyl)-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[(5-amino-6-methoxy-2-pyridinyl)-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 54993621 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-[(5-amino-6-methoxy-2-pyridinyl)-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1ccc(N)c(OC)n1 |
| InChI | InChI=1S/C11H19N3O3/c1-14(6-8(15)7-16-2)10-5-4-9(12)11(13-10)17-3/h4-5,8,15H,6-7,12H2,1-3H3 |
| InChIKey | GAHZIYHTCHFUFB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 80.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |