C8H13N3O — CID 43260741
6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine (PubChem CID 43260741) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine.
| Compound Name | 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 43260741 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine |
| SMILES | COc1nc(N(C)C)ccc1N |
| InChI | InChI=1S/C8H13N3O/c1-11(2)7-5-4-6(9)8(10-7)12-3/h4-5H,9H2,1-3H3 |
| InChIKey | ZEOLFPULWLFLOJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |