About 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine
6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine (PubChem CID 43260741) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine.
Molecular Properties
| Compound Name | 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine |
| PubChem CID | 43260741 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine |
| SMILES | COc1nc(N(C)C)ccc1N |
| InChI | InChI=1S/C8H13N3O/c1-11(2)7-5-4-6(9)8(10-7)12-3/h4-5H,9H2,1-3H3 |
| InChIKey | ZEOLFPULWLFLOJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine?
The IUPAC name of 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine (CID 43260741) is 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine.
What is the SMILES notation for 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine?
The canonical SMILES for 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine is COc1nc(N(C)C)ccc1N.
What is the InChIKey of 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine?
The InChIKey is ZEOLFPULWLFLOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-11(2)7-5-4-6(9)8(10-7)12-3/h4-5H,9H2,1-3H3.
What are the key properties of 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine?
6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine has a molecular weight of 167.21 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-N,2-N-dimethylpyridine-2,5-diamine is sourced from PubChem (CID 43260741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).