C13H18ClF3N2O — CID 102715711
2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-pentan-3-ylamino]ethanol (PubChem CID 102715711) has the molecular formula C13H18ClF3N2O and a molecular weight of 310.75 g/mol. Its IUPAC name is 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-pentan-3-ylamino]ethanol.
| Compound Name | 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-pentan-3-ylamino]ethanol |
|---|---|
| PubChem CID | 102715711 |
| Molecular Formula | C13H18ClF3N2O |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-pentan-3-ylamino]ethanol |
| SMILES | CCC(CC)N(CCO)c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C13H18ClF3N2O/c1-3-10(4-2)19(5-6-20)12-8-9(13(15,16)17)7-11(14)18-12/h7-8,10,20H,3-6H2,1-2H3 |
| InChIKey | YQMNFNCWFVRMDU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|