C11H11ClF6N2 — CID 102715736
6-chloro-N-propyl-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715736) has the molecular formula C11H11ClF6N2 and a molecular weight of 320.66 g/mol. Its IUPAC name is 6-chloro-N-propyl-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-propyl-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715736 |
| Molecular Formula | C11H11ClF6N2 |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 6-chloro-N-propyl-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCN(CC(F)(F)F)c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C11H11ClF6N2/c1-2-3-20(6-10(13,14)15)9-5-7(11(16,17)18)4-8(12)19-9/h4-5H,2-3,6H2,1H3 |
| InChIKey | LAPLWAMFTQZWPD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|