C11H17F3N4O2 — CID 114102576
N-(2,3-dimethoxypropyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 114102576) has the molecular formula C11H17F3N4O2 and a molecular weight of 294.28 g/mol. Its IUPAC name is N-(2,3-dimethoxypropyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2,3-dimethoxypropyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114102576 |
| Molecular Formula | C11H17F3N4O2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N-(2,3-dimethoxypropyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | COCC(CNc1cc(C(F)(F)F)cc(NN)n1)OC |
| InChI | InChI=1S/C11H17F3N4O2/c1-19-6-8(20-2)5-16-9-3-7(11(12,13)14)4-10(17-9)18-15/h3-4,8H,5-6,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | DGYOVNOSCGIVGN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|