C12H19F3N4O — CID 106294581
1-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]-2-methylpentan-2-ol (PubChem CID 106294581) has the molecular formula C12H19F3N4O and a molecular weight of 292.30 g/mol. Its IUPAC name is 1-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]-2-methylpentan-2-ol.
| Compound Name | 1-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 106294581 |
| Molecular Formula | C12H19F3N4O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]-2-methylpentan-2-ol |
| SMILES | CCCC(C)(O)CNc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C12H19F3N4O/c1-3-4-11(2,20)7-17-9-5-8(12(13,14)15)6-10(18-9)19-16/h5-6,20H,3-4,7,16H2,1-2H3,(H2,17,18,19) |
| InChIKey | DLKFUMXJRXBXLD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|