C12H18F3N3O — CID 102718731
3-[[[6-amino-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]pentan-3-ol (PubChem CID 102718731) has the molecular formula C12H18F3N3O and a molecular weight of 277.29 g/mol. Its IUPAC name is 3-[[[6-amino-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]pentan-3-ol.
| Compound Name | 3-[[[6-amino-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 102718731 |
| Molecular Formula | C12H18F3N3O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-[[[6-amino-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNc1cc(C(F)(F)F)cc(N)n1 |
| InChI | InChI=1S/C12H18F3N3O/c1-3-11(19,4-2)7-17-10-6-8(12(13,14)15)5-9(16)18-10/h5-6,19H,3-4,7H2,1-2H3,(H3,16,17,18) |
| InChIKey | SZJRNIFBHBJCJL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |