C10H11F6N3 — CID 102719029
6-N-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)pyridine-2,6-diamine (PubChem CID 102719029) has the molecular formula C10H11F6N3 and a molecular weight of 287.21 g/mol. Its IUPAC name is 6-N-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102719029 |
| Molecular Formula | C10H11F6N3 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 6-N-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)pyridine-2,6-diamine |
| SMILES | Nc1cc(C(F)(F)F)cc(NCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F6N3/c11-9(12,13)2-1-3-18-8-5-6(10(14,15)16)4-7(17)19-8/h4-5H,1-3H2,(H3,17,18,19) |
| InChIKey | LSSTYCDYNLCTJU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|