C8H10ClF3N4 — CID 79040692
6-chloro-4-N-(4,4,4-trifluorobutyl)pyrimidine-2,4-diamine (PubChem CID 79040692) has the molecular formula C8H10ClF3N4 and a molecular weight of 254.64 g/mol. Its IUPAC name is 6-chloro-4-N-(4,4,4-trifluorobutyl)pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(4,4,4-trifluorobutyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 79040692 |
| Molecular Formula | C8H10ClF3N4 |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 6-chloro-4-N-(4,4,4-trifluorobutyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(NCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10ClF3N4/c9-5-4-6(16-7(13)15-5)14-3-1-2-8(10,11)12/h4H,1-3H2,(H3,13,14,15,16) |
| InChIKey | HQECYLIJGVZLDA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|