C10H11ClF3N3O2 — CID 103889013
6-chloro-4-nitro-N-(5,5,5-trifluoropentyl)pyridin-2-amine (PubChem CID 103889013) has the molecular formula C10H11ClF3N3O2 and a molecular weight of 297.66 g/mol. Its IUPAC name is 6-chloro-4-nitro-N-(5,5,5-trifluoropentyl)pyridin-2-amine.
| Compound Name | 6-chloro-4-nitro-N-(5,5,5-trifluoropentyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103889013 |
| Molecular Formula | C10H11ClF3N3O2 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 6-chloro-4-nitro-N-(5,5,5-trifluoropentyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Cl)nc(NCCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H11ClF3N3O2/c11-8-5-7(17(18)19)6-9(16-8)15-4-2-1-3-10(12,13)14/h5-6H,1-4H2,(H,15,16) |
| InChIKey | NVEVFUOVIBZOCG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|