C11H15ClN4O3 — CID 113345985
3-[(6-chloro-4-nitro-2-pyridinyl)amino]-N-propylpropanamide (PubChem CID 113345985) has the molecular formula C11H15ClN4O3 and a molecular weight of 286.72 g/mol. Its IUPAC name is 3-[(6-chloro-4-nitro-2-pyridinyl)amino]-N-propylpropanamide.
| Compound Name | 3-[(6-chloro-4-nitro-2-pyridinyl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 113345985 |
| Molecular Formula | C11H15ClN4O3 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-[(6-chloro-4-nitro-2-pyridinyl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNc1cc([N+](=O)[O-])cc(Cl)n1 |
| InChI | InChI=1S/C11H15ClN4O3/c1-2-4-14-11(17)3-5-13-10-7-8(16(18)19)6-9(12)15-10/h6-7H,2-5H2,1H3,(H,13,15)(H,14,17) |
| InChIKey | PGOHVIHFXUOYHI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|