C10H14ClN4O2- — CID 7013708
6-[(2-amino-6-chloropyrimidin-4-yl)amino]hexanoate (PubChem CID 7013708) has the molecular formula C10H14ClN4O2- and a molecular weight of 257.70 g/mol. Its IUPAC name is 6-[(2-amino-6-chloropyrimidin-4-yl)amino]hexanoate.
| Compound Name | 6-[(2-amino-6-chloropyrimidin-4-yl)amino]hexanoate |
|---|---|
| PubChem CID | 7013708 |
| Molecular Formula | C10H14ClN4O2- |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 6-[(2-amino-6-chloropyrimidin-4-yl)amino]hexanoate |
| SMILES | Nc1nc(Cl)cc(NCCCCCC(=O)[O-])n1 |
| InChI | InChI=1S/C10H15ClN4O2/c11-7-6-8(15-10(12)14-7)13-5-3-1-2-4-9(16)17/h6H,1-5H2,(H,16,17)(H3,12,13,14,15)/p-1 |
| InChIKey | TXZHGQJYIKXDQE-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|