C20H24ClN5O5 — CID 15747079
(2S)-2-[[4-[4-[(2-amino-6-chloropyrimidin-4-yl)amino]butyl]benzoyl]amino]pentanedioic acid (PubChem CID 15747079) has the molecular formula C20H24ClN5O5 and a molecular weight of 449.90 g/mol. Its IUPAC name is (2S)-2-[[4-[4-[(2-amino-6-chloropyrimidin-4-yl)amino]butyl]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[4-[(2-amino-6-chloropyrimidin-4-yl)amino]butyl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 15747079 |
| Molecular Formula | C20H24ClN5O5 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (2S)-2-[[4-[4-[(2-amino-6-chloropyrimidin-4-yl)amino]butyl]benzoyl]amino]pentanedioic acid |
| SMILES | Nc1nc(Cl)cc(NCCCCc2ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C20H24ClN5O5/c21-15-11-16(26-20(22)25-15)23-10-2-1-3-12-4-6-13(7-5-12)18(29)24-14(19(30)31)8-9-17(27)28/h4-7,11,14H,1-3,8-10H2,(H,24,29)(H,27,28)(H,30,31)(H3,22,23,25,26)/t14-/m0/s1 |
| InChIKey | PZJXRFNWECZKEF-AWEZNQCLSA-N |
| XLogP | 2.19 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|