C21H26N4O6 — CID 136702970
(2S)-2-[[4-[4-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)butyl]benzoyl]amino]pentanedioic acid (PubChem CID 136702970) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is (2S)-2-[[4-[4-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)butyl]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[4-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)butyl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 136702970 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (2S)-2-[[4-[4-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)butyl]benzoyl]amino]pentanedioic acid |
| SMILES | Cc1nc(N)[nH]c(=O)c1CCCCc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C21H26N4O6/c1-12-15(19(29)25-21(22)23-12)5-3-2-4-13-6-8-14(9-7-13)18(28)24-16(20(30)31)10-11-17(26)27/h6-9,16H,2-5,10-11H2,1H3,(H,24,28)(H,26,27)(H,30,31)(H3,22,23,25,29)/t16-/m0/s1 |
| InChIKey | AEMDLHXBCDSMLG-INIZCTEOSA-N |
| XLogP | 1.27 |
| TPSA | 175.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|