C20H21N5Na2O6 — CID 137190285
D-Pemetrexed Hydrate (PubChem CID 137190285) has the molecular formula C20H21N5Na2O6 and a molecular weight of 473.40 g/mol.
| Compound Name | D-Pemetrexed Hydrate |
|---|---|
| PubChem CID | 137190285 |
| Molecular Formula | C20H21N5Na2O6 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | — |
| SMILES | Nc1nc2[nH]cc(CCc3ccc(C(=O)N[C@H](CCC(=O)O)C(=O)O)cc3)c2c(=O)[nH]1.[Na].[Na] |
| InChI | InChI=1S/C20H21N5O6.2Na/c21-20-24-16-15(18(29)25-20)12(9-22-16)6-3-10-1-4-11(5-2-10)17(28)23-13(19(30)31)7-8-14(26)27;;/h1-2,4-5,9,13H,3,6-8H2,(H,23,28)(H,26,27)(H,30,31)(H4,21,22,24,25,29);;/t13-;;/m1../s1 |
| InChIKey | PSXPIRGEVYHPKP-FFXKMJQXSA-N |
| XLogP | -0.10 |
| TPSA | 191.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |