C20H20N5O6 — CID 154730508
CID 154730508 (PubChem CID 154730508) has the molecular formula C20H20N5O6 and a molecular weight of 426.41 g/mol.
| Compound Name | CID 154730508 |
|---|---|
| PubChem CID | 154730508 |
| Molecular Formula | C20H20N5O6 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | — |
| SMILES | Nc1nc2[nH]cc(CCc3ccc(C(=O)N[C@@H](CCC([O])=O)C(=O)O)cc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C20H20N5O6/c21-20-24-16-15(18(29)25-20)12(9-22-16)6-3-10-1-4-11(5-2-10)17(28)23-13(19(30)31)7-8-14(26)27/h1-2,4-5,9,13H,3,6-8H2,(H,23,28)(H,30,31)(H4,21,22,24,25,29)/t13-/m0/s1 |
| InChIKey | SCVNUNYZBRREMY-ZDUSSCGKSA-N |
| XLogP | 0.54 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |