C19H25N2O4- — CID 2014663
6-[(6,7-diethoxyisoquinolin-3-yl)amino]hexanoate (PubChem CID 2014663) has the molecular formula C19H25N2O4- and a molecular weight of 345.42 g/mol. Its IUPAC name is 6-[(6,7-diethoxyisoquinolin-3-yl)amino]hexanoate.
| Compound Name | 6-[(6,7-diethoxyisoquinolin-3-yl)amino]hexanoate |
|---|---|
| PubChem CID | 2014663 |
| Molecular Formula | C19H25N2O4- |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 6-[(6,7-diethoxyisoquinolin-3-yl)amino]hexanoate |
| SMILES | CCOc1cc2cnc(NCCCCCC(=O)[O-])cc2cc1OCC |
| InChI | InChI=1S/C19H26N2O4/c1-3-24-16-10-14-12-18(20-9-7-5-6-8-19(22)23)21-13-15(14)11-17(16)25-4-2/h10-13H,3-9H2,1-2H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | QKENXDKCKYXWKL-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|