C12H17ClN4O — CID 114162665
5-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]pentanamide (PubChem CID 114162665) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is 5-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]pentanamide.
| Compound Name | 5-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]pentanamide |
|---|---|
| PubChem CID | 114162665 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]pentanamide |
| SMILES | NC(=O)CCCCNc1cc(Cl)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H17ClN4O/c13-9-7-11(15-6-2-1-3-10(14)18)17-12(16-9)8-4-5-8/h7-8H,1-6H2,(H2,14,18)(H,15,16,17) |
| InChIKey | JMOIWZZSFRGOSC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|