C9H13ClN4O — CID 106239916
5-[(6-chloropyrimidin-4-yl)amino]pentanamide (PubChem CID 106239916) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 5-[(6-chloropyrimidin-4-yl)amino]pentanamide.
| Compound Name | 5-[(6-chloropyrimidin-4-yl)amino]pentanamide |
|---|---|
| PubChem CID | 106239916 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 5-[(6-chloropyrimidin-4-yl)amino]pentanamide |
| SMILES | NC(=O)CCCCNc1cc(Cl)ncn1 |
| InChI | InChI=1S/C9H13ClN4O/c10-7-5-9(14-6-13-7)12-4-2-1-3-8(11)15/h5-6H,1-4H2,(H2,11,15)(H,12,13,14) |
| InChIKey | LNGBADFXIMVCNH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|