C13H18ClN3 — CID 115875632
6-chloro-2-cyclopropyl-N-(3-cyclopropylpropyl)pyrimidin-4-amine (PubChem CID 115875632) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-(3-cyclopropylpropyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-(3-cyclopropylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115875632 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-(3-cyclopropylpropyl)pyrimidin-4-amine |
| SMILES | Clc1cc(NCCCC2CC2)nc(C2CC2)n1 |
| InChI | InChI=1S/C13H18ClN3/c14-11-8-12(15-7-1-2-9-3-4-9)17-13(16-11)10-5-6-10/h8-10H,1-7H2,(H,15,16,17) |
| InChIKey | BMNMSTZXFYCJRA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|