C10H17ClN4 — CID 103463549
6-chloro-4-N-(2,2-dimethylbutyl)pyrimidine-2,4-diamine (PubChem CID 103463549) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is 6-chloro-4-N-(2,2-dimethylbutyl)pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(2,2-dimethylbutyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103463549 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 6-chloro-4-N-(2,2-dimethylbutyl)pyrimidine-2,4-diamine |
| SMILES | CCC(C)(C)CNc1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C10H17ClN4/c1-4-10(2,3)6-13-8-5-7(11)14-9(12)15-8/h5H,4,6H2,1-3H3,(H3,12,13,14,15) |
| InChIKey | UVQNBTYYGLUVFY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |