C8H9ClF3N5O — CID 156821364
N'-(2-amino-6-chloropyrimidin-4-yl)-4,4,4-trifluorobutanehydrazide (PubChem CID 156821364) has the molecular formula C8H9ClF3N5O and a molecular weight of 283.64 g/mol. Its IUPAC name is N'-(2-amino-6-chloropyrimidin-4-yl)-4,4,4-trifluorobutanehydrazide.
| Compound Name | N'-(2-amino-6-chloropyrimidin-4-yl)-4,4,4-trifluorobutanehydrazide |
|---|---|
| PubChem CID | 156821364 |
| Molecular Formula | C8H9ClF3N5O |
| Molecular Weight | 283.64 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N'-(2-amino-6-chloropyrimidin-4-yl)-4,4,4-trifluorobutanehydrazide |
| SMILES | Nc1nc(Cl)cc(NNC(=O)CCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H9ClF3N5O/c9-4-3-5(15-7(13)14-4)16-17-6(18)1-2-8(10,11)12/h3H,1-2H2,(H,17,18)(H3,13,14,15,16) |
| InChIKey | UGVLNDVPVZGTDY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.64 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|