C11H10Cl2N6O — CID 75524670
1-[(2-amino-6-chloropyrimidin-4-yl)amino]-3-(3-chlorophenyl)urea (PubChem CID 75524670) has the molecular formula C11H10Cl2N6O and a molecular weight of 313.15 g/mol. Its IUPAC name is 1-[(2-amino-6-chloropyrimidin-4-yl)amino]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[(2-amino-6-chloropyrimidin-4-yl)amino]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 75524670 |
| Molecular Formula | C11H10Cl2N6O |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 1-[(2-amino-6-chloropyrimidin-4-yl)amino]-3-(3-chlorophenyl)urea |
| SMILES | Nc1nc(Cl)cc(NNC(=O)Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C11H10Cl2N6O/c12-6-2-1-3-7(4-6)15-11(20)19-18-9-5-8(13)16-10(14)17-9/h1-5H,(H2,15,19,20)(H3,14,16,17,18) |
| InChIKey | NEGCXIMHPRQULI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|