C13H18ClN4O+ — CID 2323772
1-(3-chlorophenyl)-3-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-ylamino)urea (PubChem CID 2323772) has the molecular formula C13H18ClN4O+ and a molecular weight of 281.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-ylamino)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-ylamino)urea |
|---|---|
| PubChem CID | 2323772 |
| Molecular Formula | C13H18ClN4O+ |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-ylamino)urea |
| SMILES | O=C(NNC1=[NH+]CCCCC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClN4O/c14-10-5-4-6-11(9-10)16-13(19)18-17-12-7-2-1-3-8-15-12/h4-6,9H,1-3,7-8H2,(H,15,17)(H2,16,18,19)/p+1 |
| InChIKey | GQHCNTADKUIZFN-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|