C15H18ClN3O2 — CID 98293387
1-[[(1S,6S)-bicyclo[4.1.0]heptane-7-carbonyl]amino]-3-(3-chlorophenyl)urea (PubChem CID 98293387) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 1-[[(1S,6S)-bicyclo[4.1.0]heptane-7-carbonyl]amino]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[[(1S,6S)-bicyclo[4.1.0]heptane-7-carbonyl]amino]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 98293387 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[[(1S,6S)-bicyclo[4.1.0]heptane-7-carbonyl]amino]-3-(3-chlorophenyl)urea |
| SMILES | O=C(NNC(=O)C1[C@H]2CCCC[C@H]12)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H18ClN3O2/c16-9-4-3-5-10(8-9)17-15(21)19-18-14(20)13-11-6-1-2-7-12(11)13/h3-5,8,11-13H,1-2,6-7H2,(H,18,20)(H2,17,19,21)/t11-,12-/m0/s1 |
| InChIKey | MWCZHKHFVINOGG-RYUDHWBXSA-N |
| XLogP | 2.93 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|