C15H14Br2ClNO3 — CID 11881075
(1S,2R,3S,4R,5R,6S)-5,6-dibromo-3-[(3-chlorophenyl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 11881075) has the molecular formula C15H14Br2ClNO3 and a molecular weight of 451.54 g/mol. Its IUPAC name is (1S,2R,3S,4R,5R,6S)-5,6-dibromo-3-[(3-chlorophenyl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4R,5R,6S)-5,6-dibromo-3-[(3-chlorophenyl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 11881075 |
| Molecular Formula | C15H14Br2ClNO3 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 448.90 |
| IUPAC Name | (1S,2R,3S,4R,5R,6S)-5,6-dibromo-3-[(3-chlorophenyl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(Nc1cccc(Cl)c1)[C@@H]1[C@H]2C[C@H]([C@H](Br)[C@@H]2Br)[C@@H]1C(=O)O |
| InChI | InChI=1S/C15H14Br2ClNO3/c16-12-8-5-9(13(12)17)11(15(21)22)10(8)14(20)19-7-3-1-2-6(18)4-7/h1-4,8-13H,5H2,(H,19,20)(H,21,22)/t8-,9+,10-,11+,12-,13+/m1/s1 |
| InChIKey | WKVHFFTUPXLELD-PDWLFKFUSA-N |
| XLogP | 3.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|