C17H19N4O3S+ — CID 9452295
1-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylsulfamoyl)phenyl]-3-phenylurea (PubChem CID 9452295) has the molecular formula C17H19N4O3S+ and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylsulfamoyl)phenyl]-3-phenylurea.
| Compound Name | 1-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylsulfamoyl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 9452295 |
| Molecular Formula | C17H19N4O3S+ |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylsulfamoyl)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(S(=O)(=O)NC2=[NH+]CCC2)c1 |
| InChI | InChI=1S/C17H18N4O3S/c22-17(19-13-6-2-1-3-7-13)20-14-8-4-9-15(12-14)25(23,24)21-16-10-5-11-18-16/h1-4,6-9,12H,5,10-11H2,(H,18,21)(H2,19,20,22)/p+1 |
| InChIKey | NQNMWDYOGNYIIU-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |