C17H17FN3O3S+ — CID 7986670
N-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylsulfamoyl)phenyl]-4-fluorobenzamide (PubChem CID 7986670) has the molecular formula C17H17FN3O3S+ and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylsulfamoyl)phenyl]-4-fluorobenzamide.
| Compound Name | N-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylsulfamoyl)phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 7986670 |
| Molecular Formula | C17H17FN3O3S+ |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-pyrrol-1-ium-5-ylsulfamoyl)phenyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2=[NH+]CCC2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3O3S/c18-13-8-6-12(7-9-13)17(22)20-14-3-1-4-15(11-14)25(23,24)21-16-5-2-10-19-16/h1,3-4,6-9,11H,2,5,10H2,(H,19,21)(H,20,22)/p+1 |
| InChIKey | PTGYDMNOOLRKEC-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |