C21H16N4O5S — CID 56560659
1-[3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]-3-phenylurea (PubChem CID 56560659) has the molecular formula C21H16N4O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is 1-[3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 56560659 |
| Molecular Formula | C21H16N4O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 1-[3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(NS(=O)(=O)c2ccc3c(c2)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C21H16N4O5S/c26-19-17-10-9-16(12-18(17)20(27)24-19)31(29,30)25-15-8-4-7-14(11-15)23-21(28)22-13-5-2-1-3-6-13/h1-12,25H,(H2,22,23,28)(H,24,26,27) |
| InChIKey | OCKSYADTQDKJQZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|