C19H19N3O5S — CID 56582632
N-[[3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]methyl]-N-ethylacetamide (PubChem CID 56582632) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[[3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]methyl]-N-ethylacetamide.
| Compound Name | N-[[3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]methyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 56582632 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[[3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]methyl]-N-ethylacetamide |
| SMILES | CCN(Cc1cccc(NS(=O)(=O)c2ccc3c(c2)C(=O)NC3=O)c1)C(C)=O |
| InChI | InChI=1S/C19H19N3O5S/c1-3-22(12(2)23)11-13-5-4-6-14(9-13)21-28(26,27)15-7-8-16-17(10-15)19(25)20-18(16)24/h4-10,21H,3,11H2,1-2H3,(H,20,24,25) |
| InChIKey | BOPSUNVHNWCDMR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|