C18H14N4O4S2 — CID 56582602
N-[3-[(4-methyl-1,3-thiazol-2-yl)amino]phenyl]-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 56582602) has the molecular formula C18H14N4O4S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[3-[(4-methyl-1,3-thiazol-2-yl)amino]phenyl]-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-[3-[(4-methyl-1,3-thiazol-2-yl)amino]phenyl]-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56582602 |
| Molecular Formula | C18H14N4O4S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | N-[3-[(4-methyl-1,3-thiazol-2-yl)amino]phenyl]-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | Cc1csc(Nc2cccc(NS(=O)(=O)c3ccc4c(c3)C(=O)NC4=O)c2)n1 |
| InChI | InChI=1S/C18H14N4O4S2/c1-10-9-27-18(19-10)20-11-3-2-4-12(7-11)22-28(25,26)13-5-6-14-15(8-13)17(24)21-16(14)23/h2-9,22H,1H3,(H,19,20)(H,21,23,24) |
| InChIKey | OFFRDLXYKAPTQS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|