C12H8Cl4N4O — CID 2781839
1-(3,5-dichloroanilino)-3-(2,6-dichloro-4-pyridinyl)urea (PubChem CID 2781839) has the molecular formula C12H8Cl4N4O and a molecular weight of 366.04 g/mol. Its IUPAC name is 1-(3,5-dichloroanilino)-3-(2,6-dichloro-4-pyridinyl)urea.
| Compound Name | 1-(3,5-dichloroanilino)-3-(2,6-dichloro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 2781839 |
| Molecular Formula | C12H8Cl4N4O |
| Molecular Weight | 366.04 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 1-(3,5-dichloroanilino)-3-(2,6-dichloro-4-pyridinyl)urea |
| SMILES | O=C(NNc1cc(Cl)cc(Cl)c1)Nc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H8Cl4N4O/c13-6-1-7(14)3-9(2-6)19-20-12(21)17-8-4-10(15)18-11(16)5-8/h1-5,19H,(H2,17,18,20,21) |
| InChIKey | PTURZCZJZUKOJJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.04 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|