C10H8Cl2N2O2 — CID 95564009
N-[(3,5-dichlorophenyl)carbamoyl]prop-2-enamide (PubChem CID 95564009) has the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)carbamoyl]prop-2-enamide.
| Compound Name | N-[(3,5-dichlorophenyl)carbamoyl]prop-2-enamide |
|---|---|
| PubChem CID | 95564009 |
| Molecular Formula | C10H8Cl2N2O2 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | N-[(3,5-dichlorophenyl)carbamoyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2N2O2/c1-2-9(15)14-10(16)13-8-4-6(11)3-7(12)5-8/h2-5H,1H2,(H2,13,14,15,16) |
| InChIKey | WZPXRXWAGYGWQW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|