N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride

C7H5Cl3N2O3S — CID 151962445

IUPACN-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride
SMILESO=C(Nc1cc(Cl)cc(Cl)c1)NS(=O)(=O)Cl
InChIInChI=1S/C7H5Cl3N2O3S/c8-4-1-5(9)3-6(2-4)11-7(13)12-16(10,14)15/h1-3H,(H2,11,12,13)
InChIKeyTYYITFQKILCPNB-UHFFFAOYSA-N
MW303.55 g/mol
LogP2.60
Rot. Bonds2

About N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride

N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride (PubChem CID 151962445) has the molecular formula C7H5Cl3N2O3S and a molecular weight of 303.55 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride.

Molecular Properties

Compound NameN-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride
PubChem CID151962445
Molecular FormulaC7H5Cl3N2O3S
Molecular Weight303.55 g/mol
Exact Mass301.91
IUPAC NameN-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride
SMILESO=C(Nc1cc(Cl)cc(Cl)c1)NS(=O)(=O)Cl
InChIInChI=1S/C7H5Cl3N2O3S/c8-4-1-5(9)3-6(2-4)11-7(13)12-16(10,14)15/h1-3H,(H2,11,12,13)
InChIKeyTYYITFQKILCPNB-UHFFFAOYSA-N
XLogP2.60
TPSA75.27 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.55
LogP ≤ 52.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride?
The IUPAC name of N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride (CID 151962445) is N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride.
What is the SMILES notation for N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride?
The canonical SMILES for N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride is O=C(Nc1cc(Cl)cc(Cl)c1)NS(=O)(=O)Cl.
What is the InChIKey of N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride?
The InChIKey is TYYITFQKILCPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl3N2O3S/c8-4-1-5(9)3-6(2-4)11-7(13)12-16(10,14)15/h1-3H,(H2,11,12,13).
What are the key properties of N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride?
N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride has a molecular weight of 303.55 g/mol, XLogP of 2.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride is sourced from PubChem (CID 151962445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).