C7H5Cl3N2O3S — CID 151962445
N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride (PubChem CID 151962445) has the molecular formula C7H5Cl3N2O3S and a molecular weight of 303.55 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride.
| Compound Name | N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride |
|---|---|
| PubChem CID | 151962445 |
| Molecular Formula | C7H5Cl3N2O3S |
| Molecular Weight | 303.55 g/mol |
| Exact Mass | 301.91 |
| IUPAC Name | N-[(3,5-dichlorophenyl)carbamoyl]sulfamoyl chloride |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)NS(=O)(=O)Cl |
| InChI | InChI=1S/C7H5Cl3N2O3S/c8-4-1-5(9)3-6(2-4)11-7(13)12-16(10,14)15/h1-3H,(H2,11,12,13) |
| InChIKey | TYYITFQKILCPNB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |