C15H20Cl2N2O4 — CID 2727120
tert-butyl 2-[(3,5-dichlorophenyl)carbamoylamino]oxy-2-methylpropanoate (PubChem CID 2727120) has the molecular formula C15H20Cl2N2O4 and a molecular weight of 363.24 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)carbamoylamino]oxy-2-methylpropanoate.
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)carbamoylamino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 2727120 |
| Molecular Formula | C15H20Cl2N2O4 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)carbamoylamino]oxy-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)ONC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2O4/c1-14(2,3)22-12(20)15(4,5)23-19-13(21)18-11-7-9(16)6-10(17)8-11/h6-8H,1-5H3,(H2,18,19,21) |
| InChIKey | INUDVGVRLFKTTO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|