C18H20Cl2N2O3 — CID 113216726
1-(3,5-dichlorophenyl)-3-[2-(3,4-dimethoxyphenyl)propan-2-yl]urea (PubChem CID 113216726) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[2-(3,4-dimethoxyphenyl)propan-2-yl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[2-(3,4-dimethoxyphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 113216726 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[2-(3,4-dimethoxyphenyl)propan-2-yl]urea |
| SMILES | COc1ccc(C(C)(C)NC(=O)Nc2cc(Cl)cc(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-18(2,11-5-6-15(24-3)16(7-11)25-4)22-17(23)21-14-9-12(19)8-13(20)10-14/h5-10H,1-4H3,(H2,21,22,23) |
| InChIKey | GRIFCRIDZSRHHD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |