C15H11Cl2F3N2O2 — CID 54332053
1-(3,5-dichlorophenyl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea (PubChem CID 54332053) has the molecular formula C15H11Cl2F3N2O2 and a molecular weight of 379.17 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 54332053 |
| Molecular Formula | C15H11Cl2F3N2O2 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2F3N2O2/c1-24-13-3-2-8(15(18,19)20)4-12(13)22-14(23)21-11-6-9(16)5-10(17)7-11/h2-7H,1H3,(H2,21,22,23) |
| InChIKey | SZAGVAHIRJPKEO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |