C13H10BrF3N2O2S — CID 138720410
1-(2-bromothiophen-3-yl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea (PubChem CID 138720410) has the molecular formula C13H10BrF3N2O2S and a molecular weight of 395.20 g/mol. Its IUPAC name is 1-(2-bromothiophen-3-yl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-bromothiophen-3-yl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 138720410 |
| Molecular Formula | C13H10BrF3N2O2S |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 1-(2-bromothiophen-3-yl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)Nc1ccsc1Br |
| InChI | InChI=1S/C13H10BrF3N2O2S/c1-21-10-3-2-7(13(15,16)17)6-9(10)19-12(20)18-8-4-5-22-11(8)14/h2-6H,1H3,(H2,18,19,20) |
| InChIKey | GFXKNGDMLUTWJE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |