C15H11F4IN2O2 — CID 171063040
1-(2-fluoro-6-iodophenyl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea (PubChem CID 171063040) has the molecular formula C15H11F4IN2O2 and a molecular weight of 454.16 g/mol. Its IUPAC name is 1-(2-fluoro-6-iodophenyl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-fluoro-6-iodophenyl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 171063040 |
| Molecular Formula | C15H11F4IN2O2 |
| Molecular Weight | 454.16 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 1-(2-fluoro-6-iodophenyl)-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)Nc1c(F)cccc1I |
| InChI | InChI=1S/C15H11F4IN2O2/c1-24-12-6-5-8(15(17,18)19)7-11(12)21-14(23)22-13-9(16)3-2-4-10(13)20/h2-7H,1H3,(H2,21,22,23) |
| InChIKey | VFKMIIBCCVLMMY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.16 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|