C20H15F4N3O4 — CID 176532902
methyl (E)-3-[3-fluoro-2-[[2-(2-iminoethenoxy)-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]prop-2-enoate (PubChem CID 176532902) has the molecular formula C20H15F4N3O4 and a molecular weight of 437.35 g/mol. Its IUPAC name is methyl (E)-3-[3-fluoro-2-[[2-(2-iminoethenoxy)-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-fluoro-2-[[2-(2-iminoethenoxy)-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 176532902 |
| Molecular Formula | C20H15F4N3O4 |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | methyl (E)-3-[3-fluoro-2-[[2-(2-iminoethenoxy)-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(F)c1NC(=O)Nc1cc(C(F)(F)F)ccc1OC=C=N |
| InChI | InChI=1S/C20H15F4N3O4/c1-30-17(28)8-5-12-3-2-4-14(21)18(12)27-19(29)26-15-11-13(20(22,23)24)6-7-16(15)31-10-9-25/h2-8,10-11,25H,1H3,(H2,26,27,29)/b8-5+ |
| InChIKey | HRGPYPCEKNQRAV-VMPITWQZSA-N |
| XLogP | 4.82 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|