C19H16F4N2O3 — CID 122649739
methyl (E)-3-[3-fluoro-2-[[2-methoxy-5-(trifluoromethyl)anilino]methylideneamino]phenyl]prop-2-enoate (PubChem CID 122649739) has the molecular formula C19H16F4N2O3 and a molecular weight of 396.34 g/mol. Its IUPAC name is methyl (E)-3-[3-fluoro-2-[[2-methoxy-5-(trifluoromethyl)anilino]methylideneamino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-fluoro-2-[[2-methoxy-5-(trifluoromethyl)anilino]methylideneamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 122649739 |
| Molecular Formula | C19H16F4N2O3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | methyl (E)-3-[3-fluoro-2-[[2-methoxy-5-(trifluoromethyl)anilino]methylideneamino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(F)c1/N=C/Nc1cc(C(F)(F)F)ccc1OC |
| InChI | InChI=1S/C19H16F4N2O3/c1-27-16-8-7-13(19(21,22)23)10-15(16)24-11-25-18-12(4-3-5-14(18)20)6-9-17(26)28-2/h3-11H,1-2H3,(H,24,25)/b9-6+ |
| InChIKey | KOTVUCPVCMASAG-RMKNXTFCSA-N |
| XLogP | 4.81 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|