C30H30F4N4O4 — CID 118153701
methyl (E)-3-[3-fluoro-2-[[[4-(3-methoxyphenyl)piperazin-1-yl]-[2-methoxy-5-(trifluoromethyl)anilino]methylidene]amino]phenyl]prop-2-enoate (PubChem CID 118153701) has the molecular formula C30H30F4N4O4 and a molecular weight of 586.59 g/mol. Its IUPAC name is methyl (E)-3-[3-fluoro-2-[[[4-(3-methoxyphenyl)piperazin-1-yl]-[2-methoxy-5-(trifluoromethyl)anilino]methylidene]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-fluoro-2-[[[4-(3-methoxyphenyl)piperazin-1-yl]-[2-methoxy-5-(trifluoromethyl)anilino]methylidene]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 118153701 |
| Molecular Formula | C30H30F4N4O4 |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | methyl (E)-3-[3-fluoro-2-[[[4-(3-methoxyphenyl)piperazin-1-yl]-[2-methoxy-5-(trifluoromethyl)anilino]methylidene]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(F)c1/N=C(/Nc1cc(C(F)(F)F)ccc1OC)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C30H30F4N4O4/c1-40-23-8-5-7-22(19-23)37-14-16-38(17-15-37)29(35-25-18-21(30(32,33)34)11-12-26(25)41-2)36-28-20(6-4-9-24(28)31)10-13-27(39)42-3/h4-13,18-19H,14-17H2,1-3H3,(H,35,36)/b13-10+ |
| InChIKey | WWMNAGQOCWVLII-JLHYYAGUSA-N |
| XLogP | 5.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|