C19H25F3N4O2 — CID 143095559
1-[2-(3,4-diaminophenyl)ethyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea;ethane (PubChem CID 143095559) has the molecular formula C19H25F3N4O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 1-[2-(3,4-diaminophenyl)ethyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea;ethane.
| Compound Name | 1-[2-(3,4-diaminophenyl)ethyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea;ethane |
|---|---|
| PubChem CID | 143095559 |
| Molecular Formula | C19H25F3N4O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-[2-(3,4-diaminophenyl)ethyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea;ethane |
| SMILES | CC.COc1ccc(C(F)(F)F)cc1NC(=O)NCCc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C17H19F3N4O2.C2H6/c1-26-15-5-3-11(17(18,19)20)9-14(15)24-16(25)23-7-6-10-2-4-12(21)13(22)8-10;1-2/h2-5,8-9H,6-7,21-22H2,1H3,(H2,23,24,25);1-2H3 |
| InChIKey | PLMFTULGBZEKQC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|