C23H20F3N3O4 — CID 126669544
4-[2-[[[2-methoxy-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]benzamide (PubChem CID 126669544) has the molecular formula C23H20F3N3O4 and a molecular weight of 459.42 g/mol. Its IUPAC name is 4-[2-[[[2-methoxy-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]benzamide.
| Compound Name | 4-[2-[[[2-methoxy-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 126669544 |
| Molecular Formula | C23H20F3N3O4 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-[2-[[[2-methoxy-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]benzamide |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)NCc1ccccc1Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C23H20F3N3O4/c1-32-20-11-8-16(23(24,25)26)12-18(20)29-22(31)28-13-15-4-2-3-5-19(15)33-17-9-6-14(7-10-17)21(27)30/h2-12H,13H2,1H3,(H2,27,30)(H2,28,29,31) |
| InChIKey | WGTOYJYJLPLDDJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |