C24H23F3N2O4 — CID 135215449
1-[2-methoxy-5-(trifluoromethoxymethyl)phenyl]-3-[[2-(4-methylphenoxy)phenyl]methyl]urea (PubChem CID 135215449) has the molecular formula C24H23F3N2O4 and a molecular weight of 460.45 g/mol. Its IUPAC name is 1-[2-methoxy-5-(trifluoromethoxymethyl)phenyl]-3-[[2-(4-methylphenoxy)phenyl]methyl]urea.
| Compound Name | 1-[2-methoxy-5-(trifluoromethoxymethyl)phenyl]-3-[[2-(4-methylphenoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 135215449 |
| Molecular Formula | C24H23F3N2O4 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 1-[2-methoxy-5-(trifluoromethoxymethyl)phenyl]-3-[[2-(4-methylphenoxy)phenyl]methyl]urea |
| SMILES | COc1ccc(COC(F)(F)F)cc1NC(=O)NCc1ccccc1Oc1ccc(C)cc1 |
| InChI | InChI=1S/C24H23F3N2O4/c1-16-7-10-19(11-8-16)33-21-6-4-3-5-18(21)14-28-23(30)29-20-13-17(9-12-22(20)31-2)15-32-24(25,26)27/h3-13H,14-15H2,1-2H3,(H2,28,29,30) |
| InChIKey | SCWLYPCZNSZHSQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |