C28H30F3N3O5 — CID 147615367
1-[2-methoxy-5-(trifluoromethoxy)phenyl]-3-[[2-[[4-[4-(methylamino)butanoyl]phenyl]methoxy]phenyl]methyl]urea (PubChem CID 147615367) has the molecular formula C28H30F3N3O5 and a molecular weight of 545.56 g/mol. Its IUPAC name is 1-[2-methoxy-5-(trifluoromethoxy)phenyl]-3-[[2-[[4-[4-(methylamino)butanoyl]phenyl]methoxy]phenyl]methyl]urea.
| Compound Name | 1-[2-methoxy-5-(trifluoromethoxy)phenyl]-3-[[2-[[4-[4-(methylamino)butanoyl]phenyl]methoxy]phenyl]methyl]urea |
|---|---|
| PubChem CID | 147615367 |
| Molecular Formula | C28H30F3N3O5 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 1-[2-methoxy-5-(trifluoromethoxy)phenyl]-3-[[2-[[4-[4-(methylamino)butanoyl]phenyl]methoxy]phenyl]methyl]urea |
| SMILES | CNCCCC(=O)c1ccc(COc2ccccc2CNC(=O)Nc2cc(OC(F)(F)F)ccc2OC)cc1 |
| InChI | InChI=1S/C28H30F3N3O5/c1-32-15-5-7-24(35)20-11-9-19(10-12-20)18-38-25-8-4-3-6-21(25)17-33-27(36)34-23-16-22(39-28(29,30)31)13-14-26(23)37-2/h3-4,6,8-14,16,32H,5,7,15,17-18H2,1-2H3,(H2,33,34,36) |
| InChIKey | GCUUCWHUOQLVKH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|