C22H20F3N3O4 — CID 126669515
1-[2-methoxy-5-(trifluoromethoxy)phenyl]-3-[[2-(pyridin-3-ylmethoxy)phenyl]methyl]urea (PubChem CID 126669515) has the molecular formula C22H20F3N3O4 and a molecular weight of 447.41 g/mol. Its IUPAC name is 1-[2-methoxy-5-(trifluoromethoxy)phenyl]-3-[[2-(pyridin-3-ylmethoxy)phenyl]methyl]urea.
| Compound Name | 1-[2-methoxy-5-(trifluoromethoxy)phenyl]-3-[[2-(pyridin-3-ylmethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 126669515 |
| Molecular Formula | C22H20F3N3O4 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1-[2-methoxy-5-(trifluoromethoxy)phenyl]-3-[[2-(pyridin-3-ylmethoxy)phenyl]methyl]urea |
| SMILES | COc1ccc(OC(F)(F)F)cc1NC(=O)NCc1ccccc1OCc1cccnc1 |
| InChI | InChI=1S/C22H20F3N3O4/c1-30-20-9-8-17(32-22(23,24)25)11-18(20)28-21(29)27-13-16-6-2-3-7-19(16)31-14-15-5-4-10-26-12-15/h2-12H,13-14H2,1H3,(H2,27,28,29) |
| InChIKey | DRHOLJWBQITYCM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |