C23H20F3N3O3 — CID 126669548
4-[[2-[[[3-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]methyl]benzamide (PubChem CID 126669548) has the molecular formula C23H20F3N3O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is 4-[[2-[[[3-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]methyl]benzamide.
| Compound Name | 4-[[2-[[[3-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]methyl]benzamide |
|---|---|
| PubChem CID | 126669548 |
| Molecular Formula | C23H20F3N3O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-[[2-[[[3-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]methyl]benzamide |
| SMILES | NC(=O)c1ccc(COc2ccccc2CNC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H20F3N3O3/c24-23(25,26)18-5-3-6-19(12-18)29-22(31)28-13-17-4-1-2-7-20(17)32-14-15-8-10-16(11-9-15)21(27)30/h1-12H,13-14H2,(H2,27,30)(H2,28,29,31) |
| InChIKey | CUWAXUIRNYPREH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |