C23H20F3N3O4 — CID 150230489
N-[2-[[[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]benzamide (PubChem CID 150230489) has the molecular formula C23H20F3N3O4 and a molecular weight of 459.42 g/mol. Its IUPAC name is N-[2-[[[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]benzamide.
| Compound Name | N-[2-[[[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 150230489 |
| Molecular Formula | C23H20F3N3O4 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[2-[[[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]benzamide |
| SMILES | O=C(NCc1ccccc1ONC(=O)c1ccccc1)Nc1cc(CO)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F3N3O4/c24-23(25,26)18-10-15(14-30)11-19(12-18)28-22(32)27-13-17-8-4-5-9-20(17)33-29-21(31)16-6-2-1-3-7-16/h1-12,30H,13-14H2,(H,29,31)(H2,27,28,32) |
| InChIKey | FVJGINMZKKTCJJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|